C22H23F3N2O3 — CID 147622228
3-(4-acetylphenyl)-1-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]propan-1-one (PubChem CID 147622228) has the molecular formula C22H23F3N2O3 and a molecular weight of 420.43 g/mol. Its IUPAC name is 3-(4-acetylphenyl)-1-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]propan-1-one.
| Compound Name | 3-(4-acetylphenyl)-1-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 147622228 |
| Molecular Formula | C22H23F3N2O3 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 3-(4-acetylphenyl)-1-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]propan-1-one |
| SMILES | CC(=O)c1ccc(CCC(=O)N2CCN(c3ccc(OC(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C22H23F3N2O3/c1-16(28)18-5-2-17(3-6-18)4-11-21(29)27-14-12-26(13-15-27)19-7-9-20(10-8-19)30-22(23,24)25/h2-3,5-10H,4,11-15H2,1H3 |
| InChIKey | GECAQVRRLHZTKV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|