C16H19F3N2O3 — CID 70761890
methyl 4-[4-(4,4,4-trifluorobutanoyl)piperazin-1-yl]benzoate (PubChem CID 70761890) has the molecular formula C16H19F3N2O3 and a molecular weight of 344.33 g/mol. Its IUPAC name is methyl 4-[4-(4,4,4-trifluorobutanoyl)piperazin-1-yl]benzoate.
| Compound Name | methyl 4-[4-(4,4,4-trifluorobutanoyl)piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 70761890 |
| Molecular Formula | C16H19F3N2O3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | methyl 4-[4-(4,4,4-trifluorobutanoyl)piperazin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2CCN(C(=O)CCC(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C16H19F3N2O3/c1-24-15(23)12-2-4-13(5-3-12)20-8-10-21(11-9-20)14(22)6-7-16(17,18)19/h2-5H,6-11H2,1H3 |
| InChIKey | SKFCEVOJDMMHRL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |