C25H23F3N2O5 — CID 149069135
6-[(3aR,6aR)-2-[3-[4-(trifluoromethoxy)phenyl]propanoyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-3H-1-benzofuran-2-one (PubChem CID 149069135) has the molecular formula C25H23F3N2O5 and a molecular weight of 488.46 g/mol. Its IUPAC name is 6-[(3aR,6aR)-2-[3-[4-(trifluoromethoxy)phenyl]propanoyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-3H-1-benzofuran-2-one.
| Compound Name | 6-[(3aR,6aR)-2-[3-[4-(trifluoromethoxy)phenyl]propanoyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 149069135 |
| Molecular Formula | C25H23F3N2O5 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 6-[(3aR,6aR)-2-[3-[4-(trifluoromethoxy)phenyl]propanoyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-3H-1-benzofuran-2-one |
| SMILES | O=C1Cc2ccc(C(=O)N3C[C@H]4CN(C(=O)CCc5ccc(OC(F)(F)F)cc5)C[C@@H]4C3)cc2O1 |
| InChI | InChI=1S/C25H23F3N2O5/c26-25(27,28)35-20-6-1-15(2-7-20)3-8-22(31)29-11-18-13-30(14-19(18)12-29)24(33)17-5-4-16-10-23(32)34-21(16)9-17/h1-2,4-7,9,18-19H,3,8,10-14H2/t18-,19-/m1/s1 |
| InChIKey | QNKYXGCYDAEHPD-RTBURBONSA-N |
| XLogP | 3.21 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|