C24H27F3N4O3S — CID 162593694
[(3aR,6aR)-2-[4-[4-(trifluoromethoxy)phenyl]but-1-en-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(aminosulfonimidoyl)phenyl]methanone (PubChem CID 162593694) has the molecular formula C24H27F3N4O3S and a molecular weight of 508.57 g/mol. Its IUPAC name is [(3aR,6aR)-2-[4-[4-(trifluoromethoxy)phenyl]but-1-en-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(aminosulfonimidoyl)phenyl]methanone.
| Compound Name | [(3aR,6aR)-2-[4-[4-(trifluoromethoxy)phenyl]but-1-en-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(aminosulfonimidoyl)phenyl]methanone |
|---|---|
| PubChem CID | 162593694 |
| Molecular Formula | C24H27F3N4O3S |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | [(3aR,6aR)-2-[4-[4-(trifluoromethoxy)phenyl]but-1-en-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(aminosulfonimidoyl)phenyl]methanone |
| SMILES | [H]N=S(N)(=O)c1ccc(C(=O)N2C[C@H]3CN(C(=C)CCc4ccc(OC(F)(F)F)cc4)C[C@@H]3C2)cc1 |
| InChI | InChI=1S/C24H27F3N4O3S/c1-16(2-3-17-4-8-21(9-5-17)34-24(25,26)27)30-12-19-14-31(15-20(19)13-30)23(32)18-6-10-22(11-7-18)35(28,29)33/h4-11,19-20H,1-3,12-15H2,(H3,28,29,33)/t19-,20-/m1/s1 |
| InChIKey | BYRJOYQNANVXET-WOJBJXKFSA-N |
| XLogP | 4.01 |
| TPSA | 99.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |