C14H17N3O5S — CID 141411999
(3aR,6aS)-2-(4-sulfamoylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid (PubChem CID 141411999) has the molecular formula C14H17N3O5S and a molecular weight of 339.37 g/mol. Its IUPAC name is (3aR,6aS)-2-(4-sulfamoylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid.
| Compound Name | (3aR,6aS)-2-(4-sulfamoylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 141411999 |
| Molecular Formula | C14H17N3O5S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (3aR,6aS)-2-(4-sulfamoylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylic acid |
| SMILES | NS(=O)(=O)c1ccc(C(=O)N2C[C@H]3CN(C(=O)O)C[C@H]3C2)cc1 |
| InChI | InChI=1S/C14H17N3O5S/c15-23(21,22)12-3-1-9(2-4-12)13(18)16-5-10-7-17(14(19)20)8-11(10)6-16/h1-4,10-11H,5-8H2,(H,19,20)(H2,15,21,22)/t10-,11+ |
| InChIKey | XTRYIDCCOSWXDK-PHIMTYICSA-N |
| XLogP | 0.02 |
| TPSA | 121.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |