C16H23N3O3S — CID 136581329
4-[(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-N-ethylbenzenesulfonamide (PubChem CID 136581329) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is 4-[(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-N-ethylbenzenesulfonamide.
| Compound Name | 4-[(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 136581329 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 4-[(3aS,6aR)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-N-ethylbenzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(C(=O)N2C[C@H]3CN(C)C[C@H]3C2)cc1 |
| InChI | InChI=1S/C16H23N3O3S/c1-3-17-23(21,22)15-6-4-12(5-7-15)16(20)19-10-13-8-18(2)9-14(13)11-19/h4-7,13-14,17H,3,8-11H2,1-2H3/t13-,14+ |
| InChIKey | LRRPVBNMCQYIDU-OKILXGFUSA-N |
| XLogP | 0.62 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |