C16H24ClN3O4S — CID 154897597
4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-N-(3-hydroxypropyl)benzenesulfonamide;hydrochloride (PubChem CID 154897597) has the molecular formula C16H24ClN3O4S and a molecular weight of 389.91 g/mol. Its IUPAC name is 4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-N-(3-hydroxypropyl)benzenesulfonamide;hydrochloride.
| Compound Name | 4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-N-(3-hydroxypropyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 154897597 |
| Molecular Formula | C16H24ClN3O4S |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-N-(3-hydroxypropyl)benzenesulfonamide;hydrochloride |
| SMILES | Cl.O=C(c1ccc(S(=O)(=O)NCCCO)cc1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C16H23N3O4S.ClH/c20-7-1-6-18-24(22,23)15-4-2-12(3-5-15)16(21)19-10-13-8-17-9-14(13)11-19;/h2-5,13-14,17-18,20H,1,6-11H2;1H/t13-,14+; |
| InChIKey | JWVNCHUQEISDPF-KAECKJJSSA-N |
| XLogP | 0.06 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|