C15H18F2N2O3S — CID 120655515
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-(difluoromethylsulfonylmethyl)phenyl]methanone (PubChem CID 120655515) has the molecular formula C15H18F2N2O3S and a molecular weight of 344.38 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-(difluoromethylsulfonylmethyl)phenyl]methanone.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-(difluoromethylsulfonylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 120655515 |
| Molecular Formula | C15H18F2N2O3S |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-(difluoromethylsulfonylmethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(CS(=O)(=O)C(F)F)cc1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C15H18F2N2O3S/c16-15(17)23(21,22)9-10-1-3-11(4-2-10)14(20)19-7-12-5-18-6-13(12)8-19/h1-4,12-13,15,18H,5-9H2/t12-,13+ |
| InChIKey | PPLDTHNQMUHBBG-BETUJISGSA-N |
| XLogP | 1.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |