C16H24ClN3O3S — CID 120659487
N-[[4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]phenyl]methyl]ethanesulfonamide;hydrochloride (PubChem CID 120659487) has the molecular formula C16H24ClN3O3S and a molecular weight of 373.91 g/mol. Its IUPAC name is N-[[4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]phenyl]methyl]ethanesulfonamide;hydrochloride.
| Compound Name | N-[[4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]phenyl]methyl]ethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120659487 |
| Molecular Formula | C16H24ClN3O3S |
| Molecular Weight | 373.91 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N-[[4-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]phenyl]methyl]ethanesulfonamide;hydrochloride |
| SMILES | CCS(=O)(=O)NCc1ccc(C(=O)N2C[C@H]3CNC[C@H]3C2)cc1.Cl |
| InChI | InChI=1S/C16H23N3O3S.ClH/c1-2-23(21,22)18-7-12-3-5-13(6-4-12)16(20)19-10-14-8-17-9-15(14)11-19;/h3-6,14-15,17-18H,2,7-11H2,1H3;1H/t14-,15+; |
| InChIKey | HBZCTLJRLICDLL-KBGJBQQCSA-N |
| XLogP | 0.84 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.91 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |