C16H20N2OS2 — CID 120658067
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-(1,3-dithiolan-2-yl)phenyl]methanone (PubChem CID 120658067) has the molecular formula C16H20N2OS2 and a molecular weight of 320.48 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-(1,3-dithiolan-2-yl)phenyl]methanone.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-(1,3-dithiolan-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 120658067 |
| Molecular Formula | C16H20N2OS2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-(1,3-dithiolan-2-yl)phenyl]methanone |
| SMILES | O=C(c1ccc(C2SCCS2)cc1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C16H20N2OS2/c19-15(18-9-13-7-17-8-14(13)10-18)11-1-3-12(4-2-11)16-20-5-6-21-16/h1-4,13-14,16-17H,5-10H2/t13-,14+ |
| InChIKey | FWINXLGWPJRGBC-OKILXGFUSA-N |
| XLogP | 2.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |