C11H14N4O — CID 104671595
2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl(pyridazin-4-yl)methanone (PubChem CID 104671595) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl(pyridazin-4-yl)methanone.
| Compound Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl(pyridazin-4-yl)methanone |
|---|---|
| PubChem CID | 104671595 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl(pyridazin-4-yl)methanone |
| SMILES | O=C(c1ccnnc1)N1CC2CNCC2C1 |
| InChI | InChI=1S/C11H14N4O/c16-11(8-1-2-13-14-5-8)15-6-9-3-12-4-10(9)7-15/h1-2,5,9-10,12H,3-4,6-7H2 |
| InChIKey | QDZURGDFQIPATK-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |