C9H10BrN3O — CID 104672542
(3-bromopyrrolidin-1-yl)-pyridazin-4-ylmethanone (PubChem CID 104672542) has the molecular formula C9H10BrN3O and a molecular weight of 256.10 g/mol. Its IUPAC name is (3-bromopyrrolidin-1-yl)-pyridazin-4-ylmethanone.
| Compound Name | (3-bromopyrrolidin-1-yl)-pyridazin-4-ylmethanone |
|---|---|
| PubChem CID | 104672542 |
| Molecular Formula | C9H10BrN3O |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | (3-bromopyrrolidin-1-yl)-pyridazin-4-ylmethanone |
| SMILES | O=C(c1ccnnc1)N1CCC(Br)C1 |
| InChI | InChI=1S/C9H10BrN3O/c10-8-2-4-13(6-8)9(14)7-1-3-11-12-5-7/h1,3,5,8H,2,4,6H2 |
| InChIKey | VZZJNZAYKBAYQC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|