C11H15N5O2 — CID 113439455
N'-hydroxy-1-(pyridazine-4-carbonyl)piperidine-4-carboximidamide (PubChem CID 113439455) has the molecular formula C11H15N5O2 and a molecular weight of 249.27 g/mol. Its IUPAC name is N'-hydroxy-1-(pyridazine-4-carbonyl)piperidine-4-carboximidamide.
| Compound Name | N'-hydroxy-1-(pyridazine-4-carbonyl)piperidine-4-carboximidamide |
|---|---|
| PubChem CID | 113439455 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | N'-hydroxy-1-(pyridazine-4-carbonyl)piperidine-4-carboximidamide |
| SMILES | N/C(=N/O)C1CCN(C(=O)c2ccnnc2)CC1 |
| InChI | InChI=1S/C11H15N5O2/c12-10(15-18)8-2-5-16(6-3-8)11(17)9-1-4-13-14-7-9/h1,4,7-8,18H,2-3,5-6H2,(H2,12,15) |
| InChIKey | KDMSPUAQQUUXTK-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|