C15H16N6O — CID 97422892
[(3aR,6aS)-2-pyrimidin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-pyridazin-4-ylmethanone (PubChem CID 97422892) has the molecular formula C15H16N6O and a molecular weight of 296.33 g/mol. Its IUPAC name is [(3aR,6aS)-2-pyrimidin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-pyridazin-4-ylmethanone.
| Compound Name | [(3aR,6aS)-2-pyrimidin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-pyridazin-4-ylmethanone |
|---|---|
| PubChem CID | 97422892 |
| Molecular Formula | C15H16N6O |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | [(3aR,6aS)-2-pyrimidin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-pyridazin-4-ylmethanone |
| SMILES | O=C(c1ccnnc1)N1C[C@@H]2CN(c3ncccn3)C[C@@H]2C1 |
| InChI | InChI=1S/C15H16N6O/c22-14(11-2-5-18-19-6-11)20-7-12-9-21(10-13(12)8-20)15-16-3-1-4-17-15/h1-6,12-13H,7-10H2/t12-,13+ |
| InChIKey | FPKYSNMYTOLPGW-BETUJISGSA-N |
| XLogP | 0.47 |
| TPSA | 75.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |