C15H15FN4OS — CID 97453113
[(3aR,6aS)-2-(5-fluoropyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-thiophen-3-ylmethanone (PubChem CID 97453113) has the molecular formula C15H15FN4OS and a molecular weight of 318.38 g/mol. Its IUPAC name is [(3aR,6aS)-2-(5-fluoropyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-thiophen-3-ylmethanone.
| Compound Name | [(3aR,6aS)-2-(5-fluoropyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 97453113 |
| Molecular Formula | C15H15FN4OS |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | [(3aR,6aS)-2-(5-fluoropyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)N1C[C@@H]2CN(c3ncc(F)cn3)C[C@@H]2C1 |
| InChI | InChI=1S/C15H15FN4OS/c16-13-3-17-15(18-4-13)20-7-11-5-19(6-12(11)8-20)14(21)10-1-2-22-9-10/h1-4,9,11-12H,5-8H2/t11-,12+ |
| InChIKey | TUOJAHFBEKLDCU-TXEJJXNPSA-N |
| XLogP | 1.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |