C18H27N3O — CID 120656272
[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-[ethyl(propyl)amino]phenyl]methanone (PubChem CID 120656272) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-[ethyl(propyl)amino]phenyl]methanone.
| Compound Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-[ethyl(propyl)amino]phenyl]methanone |
|---|---|
| PubChem CID | 120656272 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | [(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-[ethyl(propyl)amino]phenyl]methanone |
| SMILES | CCCN(CC)c1ccc(C(=O)N2C[C@H]3CNC[C@H]3C2)cc1 |
| InChI | InChI=1S/C18H27N3O/c1-3-9-20(4-2)17-7-5-14(6-8-17)18(22)21-12-15-10-19-11-16(15)13-21/h5-8,15-16,19H,3-4,9-13H2,1-2H3/t15-,16+ |
| InChIKey | PCVSLBHZMBLZHX-IYBDPMFKSA-N |
| XLogP | 2.21 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |