C16H27Cl2N3O — CID 119409534
[(3R)-3-aminopyrrolidin-1-yl]-[4-[ethyl(propyl)amino]phenyl]methanone;dihydrochloride (PubChem CID 119409534) has the molecular formula C16H27Cl2N3O and a molecular weight of 348.32 g/mol. Its IUPAC name is [(3R)-3-aminopyrrolidin-1-yl]-[4-[ethyl(propyl)amino]phenyl]methanone;dihydrochloride.
| Compound Name | [(3R)-3-aminopyrrolidin-1-yl]-[4-[ethyl(propyl)amino]phenyl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119409534 |
| Molecular Formula | C16H27Cl2N3O |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | [(3R)-3-aminopyrrolidin-1-yl]-[4-[ethyl(propyl)amino]phenyl]methanone;dihydrochloride |
| SMILES | CCCN(CC)c1ccc(C(=O)N2CC[C@@H](N)C2)cc1.Cl.Cl |
| InChI | InChI=1S/C16H25N3O.2ClH/c1-3-10-18(4-2)15-7-5-13(6-8-15)16(20)19-11-9-14(17)12-19;;/h5-8,14H,3-4,9-12,17H2,1-2H3;2*1H/t14-;;/m1../s1 |
| InChIKey | OTMJKBVXTDDSOJ-FMOMHUKBSA-N |
| XLogP | 2.94 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |