C18H31Cl2N3O — CID 119487943
[4-[ethyl(propyl)amino]phenyl]-[3-(methylamino)piperidin-1-yl]methanone;dihydrochloride (PubChem CID 119487943) has the molecular formula C18H31Cl2N3O and a molecular weight of 376.37 g/mol. Its IUPAC name is [4-[ethyl(propyl)amino]phenyl]-[3-(methylamino)piperidin-1-yl]methanone;dihydrochloride.
| Compound Name | [4-[ethyl(propyl)amino]phenyl]-[3-(methylamino)piperidin-1-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119487943 |
| Molecular Formula | C18H31Cl2N3O |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | [4-[ethyl(propyl)amino]phenyl]-[3-(methylamino)piperidin-1-yl]methanone;dihydrochloride |
| SMILES | CCCN(CC)c1ccc(C(=O)N2CCCC(NC)C2)cc1.Cl.Cl |
| InChI | InChI=1S/C18H29N3O.2ClH/c1-4-12-20(5-2)17-10-8-15(9-11-17)18(22)21-13-6-7-16(14-21)19-3;;/h8-11,16,19H,4-7,12-14H2,1-3H3;2*1H |
| InChIKey | OWVFIPOWGUIHNU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |