C19H30Cl2N4O — CID 120659961
[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone;dihydrochloride (PubChem CID 120659961) has the molecular formula C19H30Cl2N4O and a molecular weight of 401.38 g/mol. Its IUPAC name is [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone;dihydrochloride.
| Compound Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 120659961 |
| Molecular Formula | C19H30Cl2N4O |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | [(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methanone;dihydrochloride |
| SMILES | CN1CCN(Cc2ccc(C(=O)N3C[C@H]4CNC[C@H]4C3)cc2)CC1.Cl.Cl |
| InChI | InChI=1S/C19H28N4O.2ClH/c1-21-6-8-22(9-7-21)12-15-2-4-16(5-3-15)19(24)23-13-17-10-20-11-18(17)14-23;;/h2-5,17-18,20H,6-14H2,1H3;2*1H/t17-,18+;; |
| InChIKey | LUDAGLARWODUJO-ULEYXFCOSA-N |
| XLogP | 1.57 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |