C16H21N3O3S — CID 120659862
4-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-N-cyclopropylbenzenesulfonamide (PubChem CID 120659862) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is 4-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-N-cyclopropylbenzenesulfonamide.
| Compound Name | 4-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-N-cyclopropylbenzenesulfonamide |
|---|---|
| PubChem CID | 120659862 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 4-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]-N-cyclopropylbenzenesulfonamide |
| SMILES | O=C(c1ccc(S(=O)(=O)NC2CC2)cc1)N1C[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C16H21N3O3S/c20-16(19-9-12-7-17-8-13(12)10-19)11-1-5-15(6-2-11)23(21,22)18-14-3-4-14/h1-2,5-6,12-14,17-18H,3-4,7-10H2/t12-,13+ |
| InChIKey | MEOLEOKSQNCJCA-BETUJISGSA-N |
| XLogP | 0.42 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |