C16H25N3O5S2 — CID 56534024
N-ethyl-4-[4-(2-methylsulfonylethyl)piperazine-1-carbonyl]benzenesulfonamide (PubChem CID 56534024) has the molecular formula C16H25N3O5S2 and a molecular weight of 403.53 g/mol. Its IUPAC name is N-ethyl-4-[4-(2-methylsulfonylethyl)piperazine-1-carbonyl]benzenesulfonamide.
| Compound Name | N-ethyl-4-[4-(2-methylsulfonylethyl)piperazine-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 56534024 |
| Molecular Formula | C16H25N3O5S2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | N-ethyl-4-[4-(2-methylsulfonylethyl)piperazine-1-carbonyl]benzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(C(=O)N2CCN(CCS(C)(=O)=O)CC2)cc1 |
| InChI | InChI=1S/C16H25N3O5S2/c1-3-17-26(23,24)15-6-4-14(5-7-15)16(20)19-10-8-18(9-11-19)12-13-25(2,21)22/h4-7,17H,3,8-13H2,1-2H3 |
| InChIKey | RWUHXVYGLVUGOF-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |