C25H23F3N4O5S — CID 123186570
4-[5-[1-(2,2,2-trifluoroethoxy)isoquinoline-3-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carbonyl]benzenesulfonamide (PubChem CID 123186570) has the molecular formula C25H23F3N4O5S and a molecular weight of 548.54 g/mol. Its IUPAC name is 4-[5-[1-(2,2,2-trifluoroethoxy)isoquinoline-3-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carbonyl]benzenesulfonamide.
| Compound Name | 4-[5-[1-(2,2,2-trifluoroethoxy)isoquinoline-3-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 123186570 |
| Molecular Formula | C25H23F3N4O5S |
| Molecular Weight | 548.54 g/mol |
| Exact Mass | 548.13 |
| IUPAC Name | 4-[5-[1-(2,2,2-trifluoroethoxy)isoquinoline-3-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carbonyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)N2CC3CN(C(=O)c4cc5ccccc5c(OCC(F)(F)F)n4)CC3C2)cc1 |
| InChI | InChI=1S/C25H23F3N4O5S/c26-25(27,28)14-37-22-20-4-2-1-3-16(20)9-21(30-22)24(34)32-12-17-10-31(11-18(17)13-32)23(33)15-5-7-19(8-6-15)38(29,35)36/h1-9,17-18H,10-14H2,(H2,29,35,36) |
| InChIKey | CQPJGPUBFZPSJE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 122.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.54 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |