C12H13F3NO3+ — CID 147490218
[1-[3-(2,2,2-trifluoroethoxy)benzoyl]azetidin-3-yl]oxidanium (PubChem CID 147490218) has the molecular formula C12H13F3NO3+ and a molecular weight of 276.23 g/mol. Its IUPAC name is [1-[3-(2,2,2-trifluoroethoxy)benzoyl]azetidin-3-yl]oxidanium.
| Compound Name | [1-[3-(2,2,2-trifluoroethoxy)benzoyl]azetidin-3-yl]oxidanium |
|---|---|
| PubChem CID | 147490218 |
| Molecular Formula | C12H13F3NO3+ |
| Molecular Weight | 276.23 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | [1-[3-(2,2,2-trifluoroethoxy)benzoyl]azetidin-3-yl]oxidanium |
| SMILES | O=C(c1cccc(OCC(F)(F)F)c1)N1CC([OH2+])C1 |
| InChI | InChI=1S/C12H12F3NO3/c13-12(14,15)7-19-10-3-1-2-8(4-10)11(18)16-5-9(17)6-16/h1-4,9,17H,5-7H2/p+1 |
| InChIKey | FFJFQKFXWCFRBU-UHFFFAOYSA-O |
| XLogP | 1.18 |
| TPSA | 52.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.23 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|