C23H23F3N6O3 — CID 140922049
2,3-dihydro-1H-benzotriazol-5-yl-[(1R,2S,6R,7S)-9-[6-(2,2,2-trifluoroethoxy)pyridine-2-carbonyl]-4,9-diazatricyclo[5.3.0.02,6]decan-4-yl]methanone (PubChem CID 140922049) has the molecular formula C23H23F3N6O3 and a molecular weight of 488.47 g/mol. Its IUPAC name is 2,3-dihydro-1H-benzotriazol-5-yl-[(1R,2S,6R,7S)-9-[6-(2,2,2-trifluoroethoxy)pyridine-2-carbonyl]-4,9-diazatricyclo[5.3.0.02,6]decan-4-yl]methanone.
| Compound Name | 2,3-dihydro-1H-benzotriazol-5-yl-[(1R,2S,6R,7S)-9-[6-(2,2,2-trifluoroethoxy)pyridine-2-carbonyl]-4,9-diazatricyclo[5.3.0.02,6]decan-4-yl]methanone |
|---|---|
| PubChem CID | 140922049 |
| Molecular Formula | C23H23F3N6O3 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | 2,3-dihydro-1H-benzotriazol-5-yl-[(1R,2S,6R,7S)-9-[6-(2,2,2-trifluoroethoxy)pyridine-2-carbonyl]-4,9-diazatricyclo[5.3.0.02,6]decan-4-yl]methanone |
| SMILES | O=C(c1ccc2c(c1)NNN2)N1C[C@@H]2[C@H](C1)[C@H]1CN(C(=O)c3cccc(OCC(F)(F)F)n3)C[C@@H]21 |
| InChI | InChI=1S/C23H23F3N6O3/c24-23(25,26)11-35-20-3-1-2-18(27-20)22(34)32-9-15-13-7-31(8-14(13)16(15)10-32)21(33)12-4-5-17-19(6-12)29-30-28-17/h1-6,13-16,28-30H,7-11H2/t13-,14+,15+,16- |
| InChIKey | FBDCHBLMEWFARX-SYMSYNOKSA-N |
| XLogP | 2.37 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |