C25H26F3N7O3 — CID 155766961
[(2S,6R)-9-[6-cyclopropyl-5-(2,2,2-trifluoroethoxy)pyridazine-3-carbonyl]-4,9-diazatricyclo[5.3.0.02,6]decan-4-yl]-(2,3-dihydro-1H-benzotriazol-5-yl)methanone (PubChem CID 155766961) has the molecular formula C25H26F3N7O3 and a molecular weight of 529.52 g/mol. Its IUPAC name is [(2S,6R)-9-[6-cyclopropyl-5-(2,2,2-trifluoroethoxy)pyridazine-3-carbonyl]-4,9-diazatricyclo[5.3.0.02,6]decan-4-yl]-(2,3-dihydro-1H-benzotriazol-5-yl)methanone.
| Compound Name | [(2S,6R)-9-[6-cyclopropyl-5-(2,2,2-trifluoroethoxy)pyridazine-3-carbonyl]-4,9-diazatricyclo[5.3.0.02,6]decan-4-yl]-(2,3-dihydro-1H-benzotriazol-5-yl)methanone |
|---|---|
| PubChem CID | 155766961 |
| Molecular Formula | C25H26F3N7O3 |
| Molecular Weight | 529.52 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | [(2S,6R)-9-[6-cyclopropyl-5-(2,2,2-trifluoroethoxy)pyridazine-3-carbonyl]-4,9-diazatricyclo[5.3.0.02,6]decan-4-yl]-(2,3-dihydro-1H-benzotriazol-5-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)NNN2)N1C[C@@H]2C3CN(C(=O)c4cc(OCC(F)(F)F)c(C5CC5)nn4)CC3[C@@H]2C1 |
| InChI | InChI=1S/C25H26F3N7O3/c26-25(27,28)11-38-21-6-20(29-32-22(21)12-1-2-12)24(37)35-9-16-14-7-34(8-15(14)17(16)10-35)23(36)13-3-4-18-19(5-13)31-33-30-18/h3-6,12,14-17,30-31,33H,1-2,7-11H2/t14-,15+,16?,17? |
| InChIKey | WYDXUHAZSWAAJI-RYTJFDOTSA-N |
| XLogP | 2.64 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.52 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |