C28H29F3N6O4 — CID 118111673
2H-benzotriazol-5-yl-[(1R,2R,6S,7S)-9-[5-(oxan-4-yl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]-4,9-diazatricyclo[5.3.0.02,6]decan-4-yl]methanone (PubChem CID 118111673) has the molecular formula C28H29F3N6O4 and a molecular weight of 570.57 g/mol. Its IUPAC name is 2H-benzotriazol-5-yl-[(1R,2R,6S,7S)-9-[5-(oxan-4-yl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]-4,9-diazatricyclo[5.3.0.02,6]decan-4-yl]methanone.
| Compound Name | 2H-benzotriazol-5-yl-[(1R,2R,6S,7S)-9-[5-(oxan-4-yl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]-4,9-diazatricyclo[5.3.0.02,6]decan-4-yl]methanone |
|---|---|
| PubChem CID | 118111673 |
| Molecular Formula | C28H29F3N6O4 |
| Molecular Weight | 570.57 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | 2H-benzotriazol-5-yl-[(1R,2R,6S,7S)-9-[5-(oxan-4-yl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]-4,9-diazatricyclo[5.3.0.02,6]decan-4-yl]methanone |
| SMILES | O=C(c1cnc(OCC(F)(F)F)c(C2CCOCC2)c1)N1C[C@@H]2[C@H](C1)[C@H]1CN(C(=O)c3ccc4n[nH]nc4c3)C[C@@H]21 |
| InChI | InChI=1S/C28H29F3N6O4/c29-28(30,31)14-41-25-18(15-3-5-40-6-4-15)7-17(9-32-25)27(39)37-12-21-19-10-36(11-20(19)22(21)13-37)26(38)16-1-2-23-24(8-16)34-35-33-23/h1-2,7-9,15,19-22H,3-6,10-14H2,(H,33,34,35)/t19-,20+,21+,22- |
| InChIKey | ONYNKDLJGOXVKM-ZDNVTZCJSA-N |
| XLogP | 3.28 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |