C26H31N5O6S — CID 118394088
5-[(3aR,6aR)-5-[5-cyclopropyl-6-(oxan-4-yloxy)pyridine-3-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carbonyl]pyridine-2-sulfonamide (PubChem CID 118394088) has the molecular formula C26H31N5O6S and a molecular weight of 541.63 g/mol. Its IUPAC name is 5-[(3aR,6aR)-5-[5-cyclopropyl-6-(oxan-4-yloxy)pyridine-3-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carbonyl]pyridine-2-sulfonamide.
| Compound Name | 5-[(3aR,6aR)-5-[5-cyclopropyl-6-(oxan-4-yloxy)pyridine-3-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carbonyl]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 118394088 |
| Molecular Formula | C26H31N5O6S |
| Molecular Weight | 541.63 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | 5-[(3aR,6aR)-5-[5-cyclopropyl-6-(oxan-4-yloxy)pyridine-3-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carbonyl]pyridine-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)N2C[C@@H]3CN(C(=O)c4cnc(OC5CCOCC5)c(C5CC5)c4)C[C@H]3C2)cn1 |
| InChI | InChI=1S/C26H31N5O6S/c27-38(34,35)23-4-3-17(10-28-23)25(32)30-12-19-14-31(15-20(19)13-30)26(33)18-9-22(16-1-2-16)24(29-11-18)37-21-5-7-36-8-6-21/h3-4,9-11,16,19-21H,1-2,5-8,12-15H2,(H2,27,34,35)/t19-,20-/m1/s1 |
| InChIKey | YLIKCNACGAJJCL-WOJBJXKFSA-N |
| XLogP | 1.40 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.63 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |