C21H29N3O3 — CID 175741648
[(3aR,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[5-cyclopropyl-6-(oxan-4-ylmethoxy)-3-pyridinyl]methanone (PubChem CID 175741648) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is [(3aR,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[5-cyclopropyl-6-(oxan-4-ylmethoxy)-3-pyridinyl]methanone.
| Compound Name | [(3aR,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[5-cyclopropyl-6-(oxan-4-ylmethoxy)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 175741648 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | [(3aR,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-[5-cyclopropyl-6-(oxan-4-ylmethoxy)-3-pyridinyl]methanone |
| SMILES | O=C(c1cnc(OCC2CCOCC2)c(C2CC2)c1)N1C[C@H]2CNC[C@@H]2C1 |
| InChI | InChI=1S/C21H29N3O3/c25-21(24-11-17-8-22-9-18(17)12-24)16-7-19(15-1-2-15)20(23-10-16)27-13-14-3-5-26-6-4-14/h7,10,14-15,17-18,22H,1-6,8-9,11-13H2/t17-,18-/m1/s1 |
| InChIKey | CYQDKNLIWWMTHT-QZTJIDSGSA-N |
| XLogP | 2.06 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |