C24H22BrF3N6O3 — CID 118111496
2H-benzotriazol-5-yl-[(1S,2S,6R,7R)-9-[5-bromo-2-methyl-6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]-4,9-diazatricyclo[5.3.0.02,6]decan-4-yl]methanone (PubChem CID 118111496) has the molecular formula C24H22BrF3N6O3 and a molecular weight of 579.38 g/mol. Its IUPAC name is 2H-benzotriazol-5-yl-[(1S,2S,6R,7R)-9-[5-bromo-2-methyl-6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]-4,9-diazatricyclo[5.3.0.02,6]decan-4-yl]methanone.
| Compound Name | 2H-benzotriazol-5-yl-[(1S,2S,6R,7R)-9-[5-bromo-2-methyl-6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]-4,9-diazatricyclo[5.3.0.02,6]decan-4-yl]methanone |
|---|---|
| PubChem CID | 118111496 |
| Molecular Formula | C24H22BrF3N6O3 |
| Molecular Weight | 579.38 g/mol |
| Exact Mass | 578.09 |
| IUPAC Name | 2H-benzotriazol-5-yl-[(1S,2S,6R,7R)-9-[5-bromo-2-methyl-6-(2,2,2-trifluoroethoxy)pyridine-3-carbonyl]-4,9-diazatricyclo[5.3.0.02,6]decan-4-yl]methanone |
| SMILES | Cc1nc(OCC(F)(F)F)c(Br)cc1C(=O)N1C[C@@H]2[C@H]3CN(C(=O)c4ccc5n[nH]nc5c4)C[C@H]3[C@@H]2C1 |
| InChI | InChI=1S/C24H22BrF3N6O3/c1-11-13(5-18(25)21(29-11)37-10-24(26,27)28)23(36)34-8-16-14-6-33(7-15(14)17(16)9-34)22(35)12-2-3-19-20(4-12)31-32-30-19/h2-5,14-17H,6-10H2,1H3,(H,30,31,32)/t14-,15+,16+,17- |
| InChIKey | RVSHWVZFEATTLW-ZYGGUILKSA-N |
| XLogP | 3.46 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |