C23H22F3N5O4 — CID 118270218
[4-(trifluoromethoxy)phenyl]methyl (3aS,7aS)-2-(2H-benzotriazole-5-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate (PubChem CID 118270218) has the molecular formula C23H22F3N5O4 and a molecular weight of 489.45 g/mol. Its IUPAC name is [4-(trifluoromethoxy)phenyl]methyl (3aS,7aS)-2-(2H-benzotriazole-5-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate.
| Compound Name | [4-(trifluoromethoxy)phenyl]methyl (3aS,7aS)-2-(2H-benzotriazole-5-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 118270218 |
| Molecular Formula | C23H22F3N5O4 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | [4-(trifluoromethoxy)phenyl]methyl (3aS,7aS)-2-(2H-benzotriazole-5-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine-5-carboxylate |
| SMILES | O=C(OCc1ccc(OC(F)(F)F)cc1)N1CC[C@@H]2CN(C(=O)c3ccc4n[nH]nc4c3)C[C@H]2C1 |
| InChI | InChI=1S/C23H22F3N5O4/c24-23(25,26)35-18-4-1-14(2-5-18)13-34-22(33)30-8-7-16-10-31(12-17(16)11-30)21(32)15-3-6-19-20(9-15)28-29-27-19/h1-6,9,16-17H,7-8,10-13H2,(H,27,28,29)/t16-,17-/m1/s1 |
| InChIKey | NKJVORRALWLGSR-IAGOWNOFSA-N |
| XLogP | 3.59 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |