C24H25F3N6O3 — CID 66600943
(3,4,5-trifluorophenyl)methyl 4-[4-(2H-benzotriazole-5-carbonyl)piperazin-1-yl]piperidine-1-carboxylate (PubChem CID 66600943) has the molecular formula C24H25F3N6O3 and a molecular weight of 502.50 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl)methyl 4-[4-(2H-benzotriazole-5-carbonyl)piperazin-1-yl]piperidine-1-carboxylate.
| Compound Name | (3,4,5-trifluorophenyl)methyl 4-[4-(2H-benzotriazole-5-carbonyl)piperazin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66600943 |
| Molecular Formula | C24H25F3N6O3 |
| Molecular Weight | 502.50 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | (3,4,5-trifluorophenyl)methyl 4-[4-(2H-benzotriazole-5-carbonyl)piperazin-1-yl]piperidine-1-carboxylate |
| SMILES | O=C(OCc1cc(F)c(F)c(F)c1)N1CCC(N2CCN(C(=O)c3ccc4n[nH]nc4c3)CC2)CC1 |
| InChI | InChI=1S/C24H25F3N6O3/c25-18-11-15(12-19(26)22(18)27)14-36-24(35)33-5-3-17(4-6-33)31-7-9-32(10-8-31)23(34)16-1-2-20-21(13-16)29-30-28-20/h1-2,11-13,17H,3-10,14H2,(H,28,29,30) |
| InChIKey | GFBLBQPXQNXOJN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|