C24H21ClF3N5O3 — CID 118555929
(E)-1-[5-(2H-benzotriazole-5-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-3-[3-chloro-5-(trifluoromethoxy)phenyl]prop-2-en-1-one (PubChem CID 118555929) has the molecular formula C24H21ClF3N5O3 and a molecular weight of 519.91 g/mol. Its IUPAC name is (E)-1-[5-(2H-benzotriazole-5-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-3-[3-chloro-5-(trifluoromethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[5-(2H-benzotriazole-5-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-3-[3-chloro-5-(trifluoromethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118555929 |
| Molecular Formula | C24H21ClF3N5O3 |
| Molecular Weight | 519.91 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | (E)-1-[5-(2H-benzotriazole-5-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-3-[3-chloro-5-(trifluoromethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc(Cl)cc(OC(F)(F)F)c1)N1CC2CCN(C(=O)c3ccc4n[nH]nc4c3)CC2C1 |
| InChI | InChI=1S/C24H21ClF3N5O3/c25-18-7-14(8-19(10-18)36-24(26,27)28)1-4-22(34)33-11-16-5-6-32(12-17(16)13-33)23(35)15-2-3-20-21(9-15)30-31-29-20/h1-4,7-10,16-17H,5-6,11-13H2,(H,29,30,31)/b4-1+ |
| InChIKey | YXAAKUPHUOLWSD-DAFODLJHSA-N |
| XLogP | 4.14 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.91 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|