C22H21N5O3 — CID 144594841
(E)-1-[5-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-(4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 144594841) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is (E)-1-[5-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-(4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[5-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 144594841 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | (E)-1-[5-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(O)cc1)N1CC2CN(C(=O)c3ccc4n[nH]nc4c3)CC2C1 |
| InChI | InChI=1S/C22H21N5O3/c28-18-5-1-14(2-6-18)3-8-21(29)26-10-16-12-27(13-17(16)11-26)22(30)15-4-7-19-20(9-15)24-25-23-19/h1-9,16-17,28H,10-13H2,(H,23,24,25)/b8-3+ |
| InChIKey | JNMUBSZFXFETNR-FPYGCLRLSA-N |
| XLogP | 1.91 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|