C23H19ClN6O2 — CID 118270829
3-[(E)-3-[(3aR,6aR)-5-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-oxoprop-1-enyl]-5-chlorobenzonitrile (PubChem CID 118270829) has the molecular formula C23H19ClN6O2 and a molecular weight of 446.90 g/mol. Its IUPAC name is 3-[(E)-3-[(3aR,6aR)-5-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-oxoprop-1-enyl]-5-chlorobenzonitrile.
| Compound Name | 3-[(E)-3-[(3aR,6aR)-5-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-oxoprop-1-enyl]-5-chlorobenzonitrile |
|---|---|
| PubChem CID | 118270829 |
| Molecular Formula | C23H19ClN6O2 |
| Molecular Weight | 446.90 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 3-[(E)-3-[(3aR,6aR)-5-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-oxoprop-1-enyl]-5-chlorobenzonitrile |
| SMILES | N#Cc1cc(Cl)cc(/C=C/C(=O)N2C[C@@H]3CN(C(=O)c4ccc5n[nH]nc5c4)C[C@H]3C2)c1 |
| InChI | InChI=1S/C23H19ClN6O2/c24-19-6-14(5-15(7-19)9-25)1-4-22(31)29-10-17-12-30(13-18(17)11-29)23(32)16-2-3-20-21(8-16)27-28-26-20/h1-8,17-18H,10-13H2,(H,26,27,28)/b4-1+/t17-,18-/m1/s1 |
| InChIKey | UKPJVILVDPYTHM-PESVTJQDSA-N |
| XLogP | 2.73 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.90 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|