C23H21Cl2N5O2 — CID 123712314
1-[(3aS,7aS)-5-(2H-benzotriazole-5-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-3-(3,5-dichlorophenyl)prop-2-en-1-one (PubChem CID 123712314) has the molecular formula C23H21Cl2N5O2 and a molecular weight of 470.36 g/mol. Its IUPAC name is 1-[(3aS,7aS)-5-(2H-benzotriazole-5-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-3-(3,5-dichlorophenyl)prop-2-en-1-one.
| Compound Name | 1-[(3aS,7aS)-5-(2H-benzotriazole-5-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-3-(3,5-dichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 123712314 |
| Molecular Formula | C23H21Cl2N5O2 |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 1-[(3aS,7aS)-5-(2H-benzotriazole-5-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-3-(3,5-dichlorophenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1cc(Cl)cc(Cl)c1)N1C[C@H]2CCN(C(=O)c3ccc4n[nH]nc4c3)C[C@@H]2C1 |
| InChI | InChI=1S/C23H21Cl2N5O2/c24-18-7-14(8-19(25)10-18)1-4-22(31)30-11-16-5-6-29(12-17(16)13-30)23(32)15-2-3-20-21(9-15)27-28-26-20/h1-4,7-10,16-17H,5-6,11-13H2,(H,26,27,28)/t16-,17-/m1/s1 |
| InChIKey | GQIHGPQIVPPQFW-IAGOWNOFSA-N |
| XLogP | 3.90 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|