C23H25Cl2N5O2 — CID 139458373
(E)-1-[2-(3-amino-4-hydrazinylbenzoyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-3-(3,5-dichlorophenyl)prop-2-en-1-one (PubChem CID 139458373) has the molecular formula C23H25Cl2N5O2 and a molecular weight of 474.39 g/mol. Its IUPAC name is (E)-1-[2-(3-amino-4-hydrazinylbenzoyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-3-(3,5-dichlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[2-(3-amino-4-hydrazinylbenzoyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-3-(3,5-dichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 139458373 |
| Molecular Formula | C23H25Cl2N5O2 |
| Molecular Weight | 474.39 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | (E)-1-[2-(3-amino-4-hydrazinylbenzoyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-3-(3,5-dichlorophenyl)prop-2-en-1-one |
| SMILES | NNc1ccc(C(=O)N2CC3CCN(C(=O)/C=C/c4cc(Cl)cc(Cl)c4)CC3C2)cc1N |
| InChI | InChI=1S/C23H25Cl2N5O2/c24-18-7-14(8-19(25)10-18)1-4-22(31)29-6-5-16-11-30(13-17(16)12-29)23(32)15-2-3-21(28-27)20(26)9-15/h1-4,7-10,16-17,28H,5-6,11-13,26-27H2/b4-1+ |
| InChIKey | CIAFLBOLUZWDPE-DAFODLJHSA-N |
| XLogP | 3.50 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|