C27H24N6O2 — CID 144594791
(E)-1-[5-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-(6-phenyl-3-pyridinyl)prop-2-en-1-one (PubChem CID 144594791) has the molecular formula C27H24N6O2 and a molecular weight of 464.53 g/mol. Its IUPAC name is (E)-1-[5-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-(6-phenyl-3-pyridinyl)prop-2-en-1-one.
| Compound Name | (E)-1-[5-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-(6-phenyl-3-pyridinyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 144594791 |
| Molecular Formula | C27H24N6O2 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | (E)-1-[5-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-(6-phenyl-3-pyridinyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(-c2ccccc2)nc1)N1CC2CN(C(=O)c3ccc4n[nH]nc4c3)CC2C1 |
| InChI | InChI=1S/C27H24N6O2/c34-26(11-7-18-6-9-23(28-13-18)19-4-2-1-3-5-19)32-14-21-16-33(17-22(21)15-32)27(35)20-8-10-24-25(12-20)30-31-29-24/h1-13,21-22H,14-17H2,(H,29,30,31)/b11-7+ |
| InChIKey | JGJZGPPIWAOWEP-YRNVUSSQSA-N |
| XLogP | 3.26 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|