C23H22FN5O2 — CID 144594838
(E)-1-[5-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-(2-fluoro-4-methylphenyl)prop-2-en-1-one (PubChem CID 144594838) has the molecular formula C23H22FN5O2 and a molecular weight of 419.46 g/mol. Its IUPAC name is (E)-1-[5-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-(2-fluoro-4-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[5-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-(2-fluoro-4-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 144594838 |
| Molecular Formula | C23H22FN5O2 |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | (E)-1-[5-(2H-benzotriazole-5-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]-3-(2-fluoro-4-methylphenyl)prop-2-en-1-one |
| SMILES | Cc1ccc(/C=C/C(=O)N2CC3CN(C(=O)c4ccc5n[nH]nc5c4)CC3C2)c(F)c1 |
| InChI | InChI=1S/C23H22FN5O2/c1-14-2-3-15(19(24)8-14)5-7-22(30)28-10-17-12-29(13-18(17)11-28)23(31)16-4-6-20-21(9-16)26-27-25-20/h2-9,17-18H,10-13H2,1H3,(H,25,26,27)/b7-5+ |
| InChIKey | BTYIAJSBSHANLM-FNORWQNLSA-N |
| XLogP | 2.65 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|