C24H24F3N5O4 — CID 135238143
1-[(3aR,6aS)-5-(2H-benzotriazole-5-carbonyl)-3a-methoxy-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]-3-[4-(trifluoromethoxy)phenyl]propan-1-one (PubChem CID 135238143) has the molecular formula C24H24F3N5O4 and a molecular weight of 503.48 g/mol. Its IUPAC name is 1-[(3aR,6aS)-5-(2H-benzotriazole-5-carbonyl)-3a-methoxy-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]-3-[4-(trifluoromethoxy)phenyl]propan-1-one.
| Compound Name | 1-[(3aR,6aS)-5-(2H-benzotriazole-5-carbonyl)-3a-methoxy-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]-3-[4-(trifluoromethoxy)phenyl]propan-1-one |
|---|---|
| PubChem CID | 135238143 |
| Molecular Formula | C24H24F3N5O4 |
| Molecular Weight | 503.48 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | 1-[(3aR,6aS)-5-(2H-benzotriazole-5-carbonyl)-3a-methoxy-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrol-2-yl]-3-[4-(trifluoromethoxy)phenyl]propan-1-one |
| SMILES | CO[C@@]12CN(C(=O)CCc3ccc(OC(F)(F)F)cc3)C[C@H]1CN(C(=O)c1ccc3n[nH]nc3c1)C2 |
| InChI | InChI=1S/C24H24F3N5O4/c1-35-23-13-31(21(33)9-4-15-2-6-18(7-3-15)36-24(25,26)27)11-17(23)12-32(14-23)22(34)16-5-8-19-20(10-16)29-30-28-19/h2-3,5-8,10,17H,4,9,11-14H2,1H3,(H,28,29,30)/t17-,23+/m0/s1 |
| InChIKey | UKINVRHVIWXVFH-GAJHUEQPSA-N |
| XLogP | 2.79 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |