C21H20F3N3O5 — CID 86299027
[4-(trifluoromethoxy)phenyl]methyl (3aS,6aS)-2-(6-oxo-1H-pyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 86299027) has the molecular formula C21H20F3N3O5 and a molecular weight of 451.40 g/mol. Its IUPAC name is [4-(trifluoromethoxy)phenyl]methyl (3aS,6aS)-2-(6-oxo-1H-pyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | [4-(trifluoromethoxy)phenyl]methyl (3aS,6aS)-2-(6-oxo-1H-pyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 86299027 |
| Molecular Formula | C21H20F3N3O5 |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | [4-(trifluoromethoxy)phenyl]methyl (3aS,6aS)-2-(6-oxo-1H-pyridine-3-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | O=C(OCc1ccc(OC(F)(F)F)cc1)N1C[C@@H]2CN(C(=O)c3ccc(=O)[nH]c3)C[C@H]2C1 |
| InChI | InChI=1S/C21H20F3N3O5/c22-21(23,24)32-17-4-1-13(2-5-17)12-31-20(30)27-10-15-8-26(9-16(15)11-27)19(29)14-3-6-18(28)25-7-14/h1-7,15-16H,8-12H2,(H,25,28)/t15-,16-/m0/s1 |
| InChIKey | ZHWSSLUBFDDWPU-HOTGVXAUSA-N |
| XLogP | 2.61 |
| TPSA | 91.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |