C13H16F3NO4 — CID 47091604
N-methoxy-3-[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]propanamide (PubChem CID 47091604) has the molecular formula C13H16F3NO4 and a molecular weight of 307.27 g/mol. Its IUPAC name is N-methoxy-3-[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]propanamide.
| Compound Name | N-methoxy-3-[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 47091604 |
| Molecular Formula | C13H16F3NO4 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-methoxy-3-[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]propanamide |
| SMILES | CONC(=O)CCc1ccc(OCC(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C13H16F3NO4/c1-19-11-7-9(4-6-12(18)17-20-2)3-5-10(11)21-8-13(14,15)16/h3,5,7H,4,6,8H2,1-2H3,(H,17,18) |
| InChIKey | WMFFVSJENNKAMO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|