C15H18F3N3O5 — CID 51131042
2-[3-[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]propanoylamino]propanediamide (PubChem CID 51131042) has the molecular formula C15H18F3N3O5 and a molecular weight of 377.32 g/mol. Its IUPAC name is 2-[3-[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]propanoylamino]propanediamide.
| Compound Name | 2-[3-[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]propanoylamino]propanediamide |
|---|---|
| PubChem CID | 51131042 |
| Molecular Formula | C15H18F3N3O5 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 2-[3-[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]propanoylamino]propanediamide |
| SMILES | COc1cc(CCC(=O)NC(C(N)=O)C(N)=O)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C15H18F3N3O5/c1-25-10-6-8(2-4-9(10)26-7-15(16,17)18)3-5-11(22)21-12(13(19)23)14(20)24/h2,4,6,12H,3,5,7H2,1H3,(H2,19,23)(H2,20,24)(H,21,22) |
| InChIKey | IZNBUKZFKROING-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 133.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|