C19H22ClF3N2O3 — CID 120568721
N-(5-amino-2-methylphenyl)-3-[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]propanamide;hydrochloride (PubChem CID 120568721) has the molecular formula C19H22ClF3N2O3 and a molecular weight of 418.84 g/mol. Its IUPAC name is N-(5-amino-2-methylphenyl)-3-[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]propanamide;hydrochloride.
| Compound Name | N-(5-amino-2-methylphenyl)-3-[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 120568721 |
| Molecular Formula | C19H22ClF3N2O3 |
| Molecular Weight | 418.84 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | N-(5-amino-2-methylphenyl)-3-[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]propanamide;hydrochloride |
| SMILES | COc1cc(CCC(=O)Nc2cc(N)ccc2C)ccc1OCC(F)(F)F.Cl |
| InChI | InChI=1S/C19H21F3N2O3.ClH/c1-12-3-6-14(23)10-15(12)24-18(25)8-5-13-4-7-16(17(9-13)26-2)27-11-19(20,21)22;/h3-4,6-7,9-10H,5,8,11,23H2,1-2H3,(H,24,25);1H |
| InChIKey | LMZHVXJZLJYKIL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.84 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|