C20H29ClN2O3 — CID 55666927
3-(3-chlorophenoxy)-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide (PubChem CID 55666927) has the molecular formula C20H29ClN2O3 and a molecular weight of 380.92 g/mol. Its IUPAC name is 3-(3-chlorophenoxy)-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide.
| Compound Name | 3-(3-chlorophenoxy)-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide |
|---|---|
| PubChem CID | 55666927 |
| Molecular Formula | C20H29ClN2O3 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 3-(3-chlorophenoxy)-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide |
| SMILES | O=C(CCOc1cccc(Cl)c1)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C20H29ClN2O3/c21-17-5-4-6-18(15-17)26-12-7-19(24)22-16-20(8-2-1-3-9-20)23-10-13-25-14-11-23/h4-6,15H,1-3,7-14,16H2,(H,22,24) |
| InChIKey | UNMGPBRZNJKEQE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |