C20H28BrN3O3 — CID 18150703
3-bromo-N-[2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl]benzamide (PubChem CID 18150703) has the molecular formula C20H28BrN3O3 and a molecular weight of 438.37 g/mol. Its IUPAC name is 3-bromo-N-[2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl]benzamide.
| Compound Name | 3-bromo-N-[2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 18150703 |
| Molecular Formula | C20H28BrN3O3 |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 3-bromo-N-[2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1cccc(Br)c1)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C20H28BrN3O3/c21-17-6-4-5-16(13-17)19(26)22-14-18(25)23-15-20(7-2-1-3-8-20)24-9-11-27-12-10-24/h4-6,13H,1-3,7-12,14-15H2,(H,22,26)(H,23,25) |
| InChIKey | QHTMEILOYXZCBT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |