C22H26BrN3O3 — CID 55659969
3-bromo-N-[2-[[2-(3-methylphenyl)-2-morpholin-4-ylethyl]amino]-2-oxoethyl]benzamide (PubChem CID 55659969) has the molecular formula C22H26BrN3O3 and a molecular weight of 460.37 g/mol. Its IUPAC name is 3-bromo-N-[2-[[2-(3-methylphenyl)-2-morpholin-4-ylethyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 3-bromo-N-[2-[[2-(3-methylphenyl)-2-morpholin-4-ylethyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 55659969 |
| Molecular Formula | C22H26BrN3O3 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 3-bromo-N-[2-[[2-(3-methylphenyl)-2-morpholin-4-ylethyl]amino]-2-oxoethyl]benzamide |
| SMILES | Cc1cccc(C(CNC(=O)CNC(=O)c2cccc(Br)c2)N2CCOCC2)c1 |
| InChI | InChI=1S/C22H26BrN3O3/c1-16-4-2-5-17(12-16)20(26-8-10-29-11-9-26)14-24-21(27)15-25-22(28)18-6-3-7-19(23)13-18/h2-7,12-13,20H,8-11,14-15H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | BIFVQFAUNPONSL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |