C21H26BrN3O2 — CID 29090501
3-bromo-N-[(2S)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ylethyl]benzamide (PubChem CID 29090501) has the molecular formula C21H26BrN3O2 and a molecular weight of 432.36 g/mol. Its IUPAC name is 3-bromo-N-[(2S)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ylethyl]benzamide.
| Compound Name | 3-bromo-N-[(2S)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ylethyl]benzamide |
|---|---|
| PubChem CID | 29090501 |
| Molecular Formula | C21H26BrN3O2 |
| Molecular Weight | 432.36 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 3-bromo-N-[(2S)-2-[4-(dimethylamino)phenyl]-2-morpholin-4-ylethyl]benzamide |
| SMILES | CN(C)c1ccc([C@@H](CNC(=O)c2cccc(Br)c2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H26BrN3O2/c1-24(2)19-8-6-16(7-9-19)20(25-10-12-27-13-11-25)15-23-21(26)17-4-3-5-18(22)14-17/h3-9,14,20H,10-13,15H2,1-2H3,(H,23,26)/t20-/m1/s1 |
| InChIKey | GABAOKRJQHXJIM-HXUWFJFHSA-N |
| XLogP | 3.32 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|