C22H28BrN3O4 — CID 55451163
3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide (PubChem CID 55451163) has the molecular formula C22H28BrN3O4 and a molecular weight of 478.39 g/mol. Its IUPAC name is 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide.
| Compound Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide |
|---|---|
| PubChem CID | 55451163 |
| Molecular Formula | C22H28BrN3O4 |
| Molecular Weight | 478.39 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 3-(5-bromo-1,3-dioxoisoindol-2-yl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide |
| SMILES | O=C(CCN1C(=O)c2ccc(Br)cc2C1=O)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C22H28BrN3O4/c23-16-4-5-17-18(14-16)21(29)26(20(17)28)9-6-19(27)24-15-22(7-2-1-3-8-22)25-10-12-30-13-11-25/h4-5,14H,1-3,6-13,15H2,(H,24,27) |
| InChIKey | QMKCFWVXAXNYLK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|