C23H31N3O4 — CID 31328500
3-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide (PubChem CID 31328500) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is 3-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide.
| Compound Name | 3-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide |
|---|---|
| PubChem CID | 31328500 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 3-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[(1-morpholin-4-ylcyclohexyl)methyl]propanamide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCC(=O)NCC1(N3CCOCC3)CCCCC1)C2=O |
| InChI | InChI=1S/C23H31N3O4/c1-17-5-6-18-19(15-17)22(29)26(21(18)28)10-7-20(27)24-16-23(8-3-2-4-9-23)25-11-13-30-14-12-25/h5-6,15H,2-4,7-14,16H2,1H3,(H,24,27) |
| InChIKey | NCKBBDVPLLNLRE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|