C18H30N4O4 — CID 131914905
2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-[(1-morpholin-4-ylcycloheptyl)methyl]acetamide (PubChem CID 131914905) has the molecular formula C18H30N4O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is 2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-[(1-morpholin-4-ylcycloheptyl)methyl]acetamide.
| Compound Name | 2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-[(1-morpholin-4-ylcycloheptyl)methyl]acetamide |
|---|---|
| PubChem CID | 131914905 |
| Molecular Formula | C18H30N4O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 2-(3-methyl-2,5-dioxoimidazolidin-1-yl)-N-[(1-morpholin-4-ylcycloheptyl)methyl]acetamide |
| SMILES | CN1CC(=O)N(CC(=O)NCC2(N3CCOCC3)CCCCCC2)C1=O |
| InChI | InChI=1S/C18H30N4O4/c1-20-13-16(24)22(17(20)25)12-15(23)19-14-18(6-4-2-3-5-7-18)21-8-10-26-11-9-21/h2-14H2,1H3,(H,19,23) |
| InChIKey | FIMRPDLVCLWIEK-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|